1122-60-7 nitrocicloesano
| Nome del prodotto |
nitrocicloesano |
| Sinonimi |
; Esaidronitrobenzene |
| Nome inglese |
nitrocyclohexane; Hexahydronitrobenzene |
| Formula molecolare |
C6H11NO2 |
| Peso Molecolare |
129.157 |
| InChI |
InChI=1/C6H11NO2/c8-7(9)6-4-2-1-3-5-6/h6H,1-5H2 |
| Numero CAS |
1122-60-7 |
| EINECS |
214-354-0 |
| Struttura molecolare |
|
| Densità |
1.05g/cm3 |
| Punto di ebollizione |
202.8°C at 760 mmHg |
| Indice di rifrazione |
1.465 |
| Punto d'infiammabilità |
81.2°C |
| Pressione di vapore |
0.287mmHg at 25°C |
| Codici di Rischio |
R23/24/25:Toxic by inhalation, in contact with skin and if swallowed.;
|
| Sicurezza Descrizione |
S28:After contact with skin, wash immediately with plenty of ...;
S36/37:Wear suitable protective clothing and gloves.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|