1122-60-7 νιτροκυκλοεξ?νιο
| Ονομασ?α του προ??ντο? |
νιτροκυκλοεξ?νιο |
| Συν?νυμα |
; Εξα?δρονιτροβενζ?λιο. |
| Αγγλικ? ?νομα |
nitrocyclohexane; Hexahydronitrobenzene |
| MF |
C6H11NO2 |
| Μοριακ? β?ρο? |
129.157 |
| InChI |
InChI=1/C6H11NO2/c8-7(9)6-4-2-1-3-5-6/h6H,1-5H2 |
| CAS ΟΧΙ |
1122-60-7 |
| EINECS |
214-354-0 |
| Μοριακ? δομ? |
|
| Πυκν?τητα |
1.05g/cm3 |
| Σημε?ο βρασμο? |
202.8°C at 760 mmHg |
| Δε?κτη? δι?θλαση? |
1.465 |
| Σημε?ο αν?φλεξη? |
81.2°C |
| Π?εση ατμ?ν |
0.287mmHg at 25°C |
| Κινδ?νου Κ?δικε? |
R23/24/25:Toxic by inhalation, in contact with skin and if swallowed.;
|
| Περιγραφ? τη? ασφ?λεια? |
S28:After contact with skin, wash immediately with plenty of ...;
S36/37:Wear suitable protective clothing and gloves.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|