111-80-8 Methyl 2-nonynoate
| Nome del prodotto |
Methyl 2-nonynoate |
| Nome inglese |
Methyl 2-nonynoate; 2-Nonynoic acid methyl ester; 2-Nonynoic acid, methyl ester; Methyl octin carbonate; Methyl octine carbonate; Octynecarboxylic acid, methyl ester; methyl non-2-ynoate |
| Formula molecolare |
C10H16O2 |
| Peso Molecolare |
168.2328 |
| InChI |
InChI=1/C10H16O2/c1-3-4-5-6-7-8-9-10(11)12-2/h3-7H2,1-2H3 |
| Numero CAS |
111-80-8 |
| EINECS |
203-909-2 |
| Struttura molecolare |
|
| Densità |
0.932g/cm3 |
| Punto di ebollizione |
233.1°C at 760 mmHg |
| Indice di rifrazione |
1.446 |
| Punto d'infiammabilità |
100.6°C |
| Pressione di vapore |
0.0568mmHg at 25°C |
| Simboli di pericolo |
Xi:Irritant;
|
| Codici di Rischio |
R36/38:Irritating to eyes and skin.;
|
| Sicurezza Descrizione |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|