111-80-8 Methyl 2-nonynoate
| Nom |
Methyl 2-nonynoate |
| Nom anglais |
Methyl 2-nonynoate; 2-Nonynoic acid methyl ester; 2-Nonynoic acid, methyl ester; Methyl octin carbonate; Methyl octine carbonate; Octynecarboxylic acid, methyl ester; methyl non-2-ynoate |
| Formule moléculaire |
C10H16O2 |
| Poids Moléculaire |
168.2328 |
| InChI |
InChI=1/C10H16O2/c1-3-4-5-6-7-8-9-10(11)12-2/h3-7H2,1-2H3 |
| Numéro de registre CAS |
111-80-8 |
| EINECS |
203-909-2 |
| Structure moléculaire |
|
| Densité |
0.932g/cm3 |
| Point d'ébullition |
233.1°C at 760 mmHg |
| Indice de réfraction |
1.446 |
| Point d'éclair |
100.6°C |
| Pression de vapeur |
0.0568mmHg at 25°C |
| Les symboles de danger |
Xi:Irritant;
|
| Codes des risques |
R36/38:Irritating to eyes and skin.;
|
| Description de sécurité |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|