ChemNet > CAS > 817-09-4 Tris(2-chloroethyl)amine hydrochloride
817-09-4 Tris(2-chloroethyl)amine hydrochloride
| ??? ????? |
Tris(2-chloroethyl)amine hydrochloride |
| ??? ??????? |
Tris(2-chloroethyl)amine hydrochloride; 2,2,2-Trichlorotriethylamine hydrochloride; 2-chloro-N,N-bis(2-chloroethyl)ethanaminium; Tris-(2-chloroethyl)amine hydrochloride |
| ????? ???????? |
C6H13Cl3N |
| ??? ??????? |
205.5326 |
| InChI |
InChI=1/C6H12Cl3N/c7-1-4-10(5-2-8)6-3-9/h1-6H2/p+1 |
| ????? ?????? |
817-09-4 |
| ????? ??????? ??????? |
212-442-3 |
| ?????? ??????? |
|
| ???? ??? |
127-132℃ |
| ???? ????? |
156.2°C at 760 mmHg |
| ???? ?????? |
48.3°C |
| ???? ???? |
2.92mmHg at 25°C |
| ??? ?????? |
T+:Very toxic;
|
| ????? ??? |
R26/27/28:Very toxic by inhalation, in contact with skin and if swallowed.;
R33:Danger of cummulative effects.;
R40:Possible risks of irreversible effects.;
|
| ??????? ????? |
S23:Do not inhale gas/fumes/vapour/spray.;
S24/25:Avoid contact with skin and eyes.;
|
|