ChemNet > CAS > 817-09-4 Tris(2-chloroethyl)amine hydrochloride
817-09-4 Tris(2-chloroethyl)amine hydrochloride
| Nama produk |
Tris(2-chloroethyl)amine hydrochloride |
| Nama bahasa Inggris |
Tris(2-chloroethyl)amine hydrochloride; 2,2,2-Trichlorotriethylamine hydrochloride; 2-chloro-N,N-bis(2-chloroethyl)ethanaminium; Tris-(2-chloroethyl)amine hydrochloride |
| MF |
C6H13Cl3N |
| Berat Molekul |
205.5326 |
| InChI |
InChI=1/C6H12Cl3N/c7-1-4-10(5-2-8)6-3-9/h1-6H2/p+1 |
| CAS NO |
817-09-4 |
| EINECS |
212-442-3 |
| Struktur Molekul |
|
| Titik lebur |
127-132℃ |
| Titik didih |
156.2°C at 760 mmHg |
| Titik nyala |
48.3°C |
| Tekanan uap |
2.92mmHg at 25°C |
| Simbol bahaya |
T+:Very toxic;
|
| Kode Risiko |
R26/27/28:Very toxic by inhalation, in contact with skin and if swallowed.;
R33:Danger of cummulative effects.;
R40:Possible risks of irreversible effects.;
|
| Keselamatan Deskripsi |
S23:Do not inhale gas/fumes/vapour/spray.;
S24/25:Avoid contact with skin and eyes.;
|
|