4295-06-1 4-Chloroquinaldine
| ??? ????? |
4-Chloroquinaldine |
| ??? ??????? |
4-Chloroquinaldine; 4-Chloro-2-methylquinoline; 2-Methyl-4-chloroquinoline |
| ????? ???????? |
C10H8ClN |
| ??? ??????? |
177.6302 |
| InChI |
InChI=1/C10H8ClN/c1-7-6-9(11)8-4-2-3-5-10(8)12-7/h2-6H,1H3 |
| ????? ?????? |
4295-06-1 |
| ????? ??????? ??????? |
224-300-8 |
| ?????? ??????? |
|
| ????? |
1.225g/cm3 |
| ???? ??? |
39-270℃ |
| ???? ????? |
269.5°C at 760 mmHg |
| ???? ???? |
1.634 |
| ???? ?????? |
140.2°C |
| ???? ???? |
0.012mmHg at 25°C |
| ????? ??? |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| ??????? ????? |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|