4295-06-1 4-Chloroquinaldine
| product Name |
4-Chloroquinaldine |
| CAS No |
4295-06-1 |
| Synonyms |
4-Chloro-2-methylquinoline; 2-Methyl-4-chloroquinoline |
| Molecular Formula |
C10H8ClN |
| Molecular Weight |
177.6302 |
| InChI |
InChI=1/C10H8ClN/c1-7-6-9(11)8-4-2-3-5-10(8)12-7/h2-6H,1H3 |
| EINECS |
224-300-8 |
| Molecular Structure |
|
| Density |
1.225g/cm3 |
| Melting point |
39-270℃ |
| Boiling point |
269.5°C at 760 mmHg |
| Refractive index |
1.634 |
| Flash point |
140.2°C |
| Vapour Pressur |
0.012mmHg at 25°C |
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
Featured China Suppliers
| Contact |
Mr Huang |
| Telephone |
+86-571-86066502;18958062155 |
| Email |
sales@shuypharm.com |
| Address |
No. 590, Wenyi West Road, Hangzhou, Zhejiang, China |