ChemNet > CAS > 99-42-3 Methyl 4-hydroxy-3-nitrobenzoate
99-42-3 Methyl 4-hydroxy-3-nitrobenzoate
| ?????? ?? ??? |
Methyl 4-hydroxy-3-nitrobenzoate |
| ???????? ??? |
Methyl 4-hydroxy-3-nitrobenzoate; 4-Hydroxy-3-nitrobenzoic acid methyl ester; Methyl 3-nitro-4-hydroxybenzoate; 4-(methoxycarbonyl)-2-nitrophenolate; 3-nitro-4-hydroxymethyl benzoate |
| ????? ???????? |
C8H6NO5 |
| ?????? ??? |
196.1375 |
| InChI |
InChI=1/C8H7NO5/c1-14-8(11)5-2-3-7(10)6(4-5)9(12)13/h2-4,10H,1H3/p-1 |
| ??? ??????? ?????? |
99-42-3 |
| EINECS |
202-755-3 |
| ????? ?????? |
|
| ?????? |
74-76℃ |
| ????? ?? ??? |
311.1°C at 760 mmHg |
| ????? ??????? |
141.9°C |
| ????? ?? ???? |
0.000315mmHg at 25°C |
| ???? ?? ??? |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| ??????? ????? |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|