ChemNet > CAS > 99-42-3 Methyl 4-hydroxy-3-nitrobenzoate
99-42-3 Methyl 4-hydroxy-3-nitrobenzoate
| Ονομασ?α του προ??ντο? |
Methyl 4-hydroxy-3-nitrobenzoate |
| Αγγλικ? ?νομα |
Methyl 4-hydroxy-3-nitrobenzoate; 4-Hydroxy-3-nitrobenzoic acid methyl ester; Methyl 3-nitro-4-hydroxybenzoate; 4-(methoxycarbonyl)-2-nitrophenolate; 3-nitro-4-hydroxymethyl benzoate |
| MF |
C8H6NO5 |
| Μοριακ? β?ρο? |
196.1375 |
| InChI |
InChI=1/C8H7NO5/c1-14-8(11)5-2-3-7(10)6(4-5)9(12)13/h2-4,10H,1H3/p-1 |
| CAS ΟΧΙ |
99-42-3 |
| EINECS |
202-755-3 |
| Μοριακ? δομ? |
|
| Σημε?ο τ?ξη? |
74-76℃ |
| Σημε?ο βρασμο? |
311.1°C at 760 mmHg |
| Σημε?ο αν?φλεξη? |
141.9°C |
| Π?εση ατμ?ν |
0.000315mmHg at 25°C |
| Κινδ?νου Κ?δικε? |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Περιγραφ? τη? ασφ?λεια? |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|