98-81-7 alpha-bromostyrene
| ?????? ?? ??? |
alpha-bromostyrene |
| ???????? ??? |
alpha-bromostyrene; 1-(1-Bromovinyl)benzene; (1-bromoethenyl)benzene |
| ????? ???????? |
C8H7Br |
| ?????? ??? |
183.0452 |
| InChI |
InChI=1/C8H7Br/c1-7(9)8-5-3-2-4-6-8/h2-6H,1H2 |
| ??? ??????? ?????? |
98-81-7 |
| EINECS |
202-702-4 |
| ????? ?????? |
|
| ????? |
1.387g/cm3 |
| ?????? |
-44℃ |
| ????? ?? ??? |
212.6°C at 760 mmHg |
| ??????? ??????? |
1.574 |
| ????? ??????? |
98.3°C |
| ????? ?? ???? |
0.249mmHg at 25°C |
| ???? ?????? |
Xi:Irritant;
|
| ???? ?? ??? |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| ??????? ????? |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|