98-81-7 alpha-bromostyrene
| termék neve |
alpha-bromostyrene |
| Angol név |
alpha-bromostyrene; 1-(1-Bromovinyl)benzene; (1-bromoethenyl)benzene |
| MF |
C8H7Br |
| Molekulat?meg |
183.0452 |
| InChI |
InChI=1/C8H7Br/c1-7(9)8-5-3-2-4-6-8/h2-6H,1H2 |
| CAS-szám |
98-81-7 |
| EINECS |
202-702-4 |
| Molekuláris szerkezete |
|
| S?r?ség |
1.387g/cm3 |
| Olvadáspont |
-44℃ |
| Forráspont |
212.6°C at 760 mmHg |
| T?résmutató |
1.574 |
| Gyulladáspont |
98.3°C |
| G?znyomás |
0.249mmHg at 25°C |
| Veszély szimbólumok |
Xi:Irritant;
|
| Kockázatot kódok |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Biztonsági Leírás |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|