ChemNet > CAS > 794-94-5 4-Methoxybenzoic anhydride
794-94-5 4-Methoxybenzoic anhydride
| ?????? ?? ??? |
4-Methoxybenzoic anhydride |
| ???????? ??? |
4-Methoxybenzoic anhydride; p-Anisic anhydride |
| ????? ???????? |
C16H14O5 |
| ?????? ??? |
286.2794 |
| InChI |
InChI=1/C16H14O5/c1-19-13-7-3-11(4-8-13)15(17)21-16(18)12-5-9-14(20-2)10-6-12/h3-10H,1-2H3 |
| ??? ??????? ?????? |
794-94-5 |
| EINECS |
212-345-6 |
| ????? ?????? |
|
| ????? |
1.219g/cm3 |
| ?????? |
92-97℃ |
| ????? ?? ??? |
453.5°C at 760 mmHg |
| ??????? ??????? |
1.563 |
| ????? ??????? |
202.3°C |
| ????? ?? ???? |
2.06E-08mmHg at 25°C |
| ???? ?? ??? |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| ??????? ????? |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|