ChemNet > CAS > 794-94-5 4-Methoxybenzoic anhydride
794-94-5 4-Methoxybenzoic anhydride
| Produkt-Name |
4-Methoxybenzoic anhydride |
| Englischer Name |
4-Methoxybenzoic anhydride; p-Anisic anhydride |
| Molekulare Formel |
C16H14O5 |
| Molecular Weight |
286.2794 |
| InChI |
InChI=1/C16H14O5/c1-19-13-7-3-11(4-8-13)15(17)21-16(18)12-5-9-14(20-2)10-6-12/h3-10H,1-2H3 |
| CAS Registry Number |
794-94-5 |
| EINECS |
212-345-6 |
| Molecular Structure |
|
| Dichte |
1.219g/cm3 |
| Schmelzpunkt |
92-97℃ |
| Siedepunkt |
453.5°C at 760 mmHg |
| Brechungsindex |
1.563 |
| Flammpunkt |
202.3°C |
| Dampfdruck |
2.06E-08mmHg at 25°C |
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Beschreibung |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|