4892-02-8 methyl thiosalicylate
| ?????? ?? ??? |
methyl thiosalicylate |
| ???????? ??? |
methyl thiosalicylate; Methyl 2-mercaptobenzoate; 2-Mercaptobenzoic acid methyl ester; methyl 2-sulfanylbenzoate; methoxy(6-thioxocyclohexa-2,4-dien-1-ylidene)methanolate |
| ????? ???????? |
C8H7O2S |
| ?????? ??? |
167.2055 |
| InChI |
InChI=1/C8H8O2S/c1-10-8(9)6-4-2-3-5-7(6)11/h2-5,9H,1H3/p-1 |
| ??? ??????? ?????? |
4892-02-8 |
| ????? ?????? |
|
| ????? ?? ??? |
240°C at 760 mmHg |
| ????? ??????? |
98.9°C |
| ????? ?? ???? |
0.00681mmHg at 25°C |
| ???? ?????? |
Xn:Harmful;
|
| ???? ?? ??? |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| ??????? ????? |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|