4892-02-8 methyl thiosalicylate
| termék neve |
methyl thiosalicylate |
| Angol név |
methyl thiosalicylate; Methyl 2-mercaptobenzoate; 2-Mercaptobenzoic acid methyl ester; methyl 2-sulfanylbenzoate; methoxy(6-thioxocyclohexa-2,4-dien-1-ylidene)methanolate |
| MF |
C8H7O2S |
| Molekulat?meg |
167.2055 |
| InChI |
InChI=1/C8H8O2S/c1-10-8(9)6-4-2-3-5-7(6)11/h2-5,9H,1H3/p-1 |
| CAS-szám |
4892-02-8 |
| Molekuláris szerkezete |
|
| Forráspont |
240°C at 760 mmHg |
| Gyulladáspont |
98.9°C |
| G?znyomás |
0.00681mmHg at 25°C |
| Veszély szimbólumok |
Xn:Harmful;
|
| Kockázatot kódok |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Biztonsági Leírás |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|