89-79-2 Isopulegol
| Nama produk |
Isopulegol |
| Sinonim |
; 1-Metil-4-isopropenylcyclohexan-3-ol; p-menth-8-en-3-ol; (1R,2S,5R)-5-metil-2-(prop-1-en-2-yl)sikloheksanol |
| Nama bahasa Inggris |
Isopulegol; 1-Methyl-4-isopropenylcyclohexan-3-ol; p-menth-8-en-3-ol; (1R,2S,5R)-5-methyl-2-(prop-1-en-2-yl)cyclohexanol |
| MF |
C10H18O |
| Berat Molekul |
154.2493 |
| InChI |
InChI=1/C10H18O/c1-7(2)9-5-4-8(3)6-10(9)11/h8-11H,1,4-6H2,2-3H3/t8-,9+,10-/m1/s1 |
| CAS NO |
89-79-2 |
| EINECS |
201-940-6 |
| Struktur Molekul |
|
| Kepadatan |
0.912g/cm3 |
| Titik didih |
197°C at 760 mmHg |
| Indeks bias |
1.472 |
| Titik nyala |
78.3°C |
| Tekanan uap |
0.0993mmHg at 25°C |
| Simbol bahaya |
Xn:Harmful;
|
| Kode Risiko |
R21/22:Harmful in contact with skin and if swallowed.;
|
|