89-79-2 Isopulegol
| product Name |
Isopulegol |
| CAS No |
89-79-2 |
| Synonyms |
1-Methyl-4-isopropenylcyclohexan-3-ol; p-menth-8-en-3-ol; (1R,2S,5R)-5-methyl-2-(prop-1-en-2-yl)cyclohexanol |
| Molecular Formula |
C10H18O |
| Molecular Weight |
154.2493 |
| InChI |
InChI=1/C10H18O/c1-7(2)9-5-4-8(3)6-10(9)11/h8-11H,1,4-6H2,2-3H3/t8-,9+,10-/m1/s1 |
| EINECS |
201-940-6 |
| Molecular Structure |
|
| Density |
0.912g/cm3 |
| Boiling point |
197°C at 760 mmHg |
| Refractive index |
1.472 |
| Flash point |
78.3°C |
| Vapour Pressur |
0.0993mmHg at 25°C |
| Hazard Symbols |
Xn:Harmful;
|
| Risk Codes |
R21/22:Harmful in contact with skin and if swallowed.;
|
| MSDS |
Material Safety Data Sheet
|
|
Featured China Suppliers
| Contact |
Michael Gan(garoms) |
| Telephone |
+86-573-82262042 |
| Email |
garoms@163.com |
| Address |
No.225, Dongqing Road |