89-79-2 Isopulegol?
| Nom |
Isopulegol? |
| Synonymes |
; 1-méthyl-4-isopropénylcyclohexan-3-ol?; p-menth-8-fr-3-ol?; (1R,2S,5R)-5-méthyl-2-(prop-1-en-2-yl)cyclohexanol? |
| Nom anglais |
Isopulegol; 1-Methyl-4-isopropenylcyclohexan-3-ol; p-menth-8-en-3-ol; (1R,2S,5R)-5-methyl-2-(prop-1-en-2-yl)cyclohexanol |
| Formule moléculaire |
C10H18O |
| Poids Moléculaire |
154.2493 |
| InChI |
InChI=1/C10H18O/c1-7(2)9-5-4-8(3)6-10(9)11/h8-11H,1,4-6H2,2-3H3/t8-,9+,10-/m1/s1 |
| Numéro de registre CAS |
89-79-2 |
| EINECS |
201-940-6 |
| Structure moléculaire |
|
| Densité |
0.912g/cm3 |
| Point d'ébullition |
197°C at 760 mmHg |
| Indice de réfraction |
1.472 |
| Point d'éclair |
78.3°C |
| Pression de vapeur |
0.0993mmHg at 25°C |
| Les symboles de danger |
Xn:Harmful;
|
| Codes des risques |
R21/22:Harmful in contact with skin and if swallowed.;
|
|