4426-76-0 2-Isothiochroman-4-one
| Nama produk |
2-Isothiochroman-4-one |
| Nama bahasa Inggris |
2-Isothiochroman-4-one;Isothiochromanone; NSC 208878; 1H-2-Benzothiopyran-4(3H)-one (9CI); 1H-isothiochromen-4(3H)-one |
| MF |
C9H8OS |
| Berat Molekul |
164.2242 |
| InChI |
InChI=1/C9H8OS/c10-9-6-11-5-7-3-1-2-4-8(7)9/h1-4H,5-6H2 |
| CAS NO |
4426-76-0 |
| Struktur Molekul |
|
| Kepadatan |
1.241g/cm3 |
| Titik didih |
315.1°C at 760 mmHg |
| Indeks bias |
1.624 |
| Titik nyala |
173.3°C |
| Tekanan uap |
0.000448mmHg at 25°C |
| Keselamatan Deskripsi |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|