4426-76-0 2-Isothiochroman-4-one
| product Name |
2-Isothiochroman-4-one |
| CAS No |
4426-76-0 |
| Synonyms |
Isothiochromanone; NSC 208878; 1H-2-Benzothiopyran-4(3H)-one (9CI); 1H-isothiochromen-4(3H)-one |
| Molecular Formula |
C9H8OS |
| Molecular Weight |
164.2242 |
| InChI |
InChI=1/C9H8OS/c10-9-6-11-5-7-3-1-2-4-8(7)9/h1-4H,5-6H2 |
| Molecular Structure |
|
| Density |
1.241g/cm3 |
| Boiling point |
315.1°C at 760 mmHg |
| Refractive index |
1.624 |
| Flash point |
173.3°C |
| Vapour Pressur |
0.000448mmHg at 25°C |
| Safety Description |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|