4312-99-6 1-Octen-3-one
| Nama produk |
1-Octen-3-one |
| Nama bahasa Inggris |
1-Octen-3-one; n-Amyl vinyl ketone~n-Pentyl vinyl ketone; oct-1-en-3-one |
| MF |
C8H14O |
| Berat Molekul |
126.1962 |
| InChI |
InChI=1/C8H14O/c1-3-5-6-7-8(9)4-2/h4H,2-3,5-7H2,1H3 |
| CAS NO |
4312-99-6 |
| EINECS |
224-327-5 |
| Struktur Molekul |
|
| Kepadatan |
0.825g/cm3 |
| Titik didih |
177°C at 760 mmHg |
| Indeks bias |
1.422 |
| Titik nyala |
58.5°C |
| Tekanan uap |
1.06mmHg at 25°C |
| Kode Risiko |
R10:Flammable.;
R36/38:Irritating to eyes and skin.;
|
| Keselamatan Deskripsi |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|