4312-99-6 1-Octen-3-one
| Produkt-Name |
1-Octen-3-one |
| Englischer Name |
1-Octen-3-one; n-Amyl vinyl ketone~n-Pentyl vinyl ketone; oct-1-en-3-one |
| Molekulare Formel |
C8H14O |
| Molecular Weight |
126.1962 |
| InChI |
InChI=1/C8H14O/c1-3-5-6-7-8(9)4-2/h4H,2-3,5-7H2,1H3 |
| CAS Registry Number |
4312-99-6 |
| EINECS |
224-327-5 |
| Molecular Structure |
|
| Dichte |
0.825g/cm3 |
| Siedepunkt |
177°C at 760 mmHg |
| Brechungsindex |
1.422 |
| Flammpunkt |
58.5°C |
| Dampfdruck |
1.06mmHg at 25°C |
| Risk Codes |
R10:Flammable.;
R36/38:Irritating to eyes and skin.;
|
| Safety Beschreibung |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|