4250-77-5 6-Hydroxyflavanone
| Nama produk |
6-Hydroxyflavanone |
| Nama bahasa Inggris |
6-Hydroxyflavanone;(2R)-6-hydroxy-2-phenyl-2,3-dihydro-4H-chromen-4-one; (2S)-6-hydroxy-2-phenyl-2,3-dihydro-4H-chromen-4-one; 6-hydroxy-2-phenyl-2,3-dihydro-4H-chromen-4-one |
| MF |
C15H12O3 |
| Berat Molekul |
240.254 |
| InChI |
InChI=1/C15H12O3/c16-11-6-7-14-12(8-11)13(17)9-15(18-14)10-4-2-1-3-5-10/h1-8,15-16H,9H2 |
| CAS NO |
4250-77-5 |
| Struktur Molekul |
|
| Kepadatan |
1.288g/cm3 |
| Titik lebur |
220-222℃ |
| Titik didih |
464.3°C at 760 mmHg |
| Indeks bias |
1.631 |
| Titik nyala |
181.2°C |
| Tekanan uap |
3.05E-09mmHg at 25°C |
| Simbol bahaya |
Xi:Irritant;
|
| Kode Risiko |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Keselamatan Deskripsi |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|