4250-77-5 6-Hydroxyflavanone
| product Name |
6-Hydroxyflavanone |
| CAS No |
4250-77-5 |
| Synonyms |
(2R)-6-hydroxy-2-phenyl-2,3-dihydro-4H-chromen-4-one; (2S)-6-hydroxy-2-phenyl-2,3-dihydro-4H-chromen-4-one; 6-hydroxy-2-phenyl-2,3-dihydro-4H-chromen-4-one |
| Molecular Formula |
C15H12O3 |
| Molecular Weight |
240.254 |
| InChI |
InChI=1/C15H12O3/c16-11-6-7-14-12(8-11)13(17)9-15(18-14)10-4-2-1-3-5-10/h1-8,15-16H,9H2 |
| Molecular Structure |
|
| Density |
1.288g/cm3 |
| Melting point |
220-222℃ |
| Boiling point |
464.3°C at 760 mmHg |
| Refractive index |
1.631 |
| Flash point |
181.2°C |
| Vapour Pressur |
3.05E-09mmHg at 25°C |
| Hazard Symbols |
Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
| MSDS |
Material Safety Data Sheet
|
|