4712-55-4 Diphenyl phosphite
| termék neve |
Diphenyl phosphite |
| Angol név |
Diphenyl phosphite; diphenyl phosphonate; Phosphonic acid diphenyl ester; diphenyl hydrogen phosphite; oxo(diphenoxy)phosphonium |
| MF |
C12H11O3P |
| Molekulat?meg |
234.1877 |
| InChI |
InChI=1/C12H11O3P/c13-16(14-11-7-3-1-4-8-11)15-12-9-5-2-6-10-12/h1-10,16H |
| CAS-szám |
4712-55-4 |
| EINECS |
225-202-8 |
| Molekuláris szerkezete |
|
| Olvadáspont |
12℃ |
| Forráspont |
348.233°C at 760 mmHg |
| Gyulladáspont |
178.834°C |
| G?znyomás |
0mmHg at 25°C |
| Veszély szimbólumok |
C:Corrosive;
|
| Kockázatot kódok |
R34:Causes burns.;
|
| Biztonsági Leírás |
S24/25:Avoid contact with skin and eyes.;
|
|