4712-55-4 Diphenyl phosphite
| product Name |
Diphenyl phosphite |
| CAS No |
4712-55-4 |
| Synonyms |
diphenyl phosphonate; Phosphonic acid diphenyl ester; diphenyl hydrogen phosphite; oxo(diphenoxy)phosphonium |
| Molecular Formula |
C12H11O3P |
| Molecular Weight |
234.1877 |
| InChI |
InChI=1/C12H11O3P/c13-16(14-11-7-3-1-4-8-11)15-12-9-5-2-6-10-12/h1-10,16H |
| EINECS |
225-202-8 |
| Molecular Structure |
|
| Melting point |
12℃ |
| Boiling point |
348.233°C at 760 mmHg |
| Flash point |
178.834°C |
| Vapour Pressur |
0mmHg at 25°C |
| Hazard Symbols |
C:Corrosive;
|
| Risk Codes |
R34:Causes burns.;
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
Featured China Suppliers
| Telephone |
0511-89986366 |
| Email |
sales@china-ch.com |
| Address |
No.188??jingang Avenue??Dagang??Zhenjiang ??jiangsu??China |
| Contact |
Mr Huang |
| Telephone |
+86-571-86066502;18958062155 |
| Email |
sales@shuypharm.com |
| Address |
No. 590, Wenyi West Road, Hangzhou, Zhejiang, China |