91-48-5 alpha-Phenylcinnamic acid
| Ονομασ?α του προ??ντο? |
alpha-Phenylcinnamic acid |
| Αγγλικ? ?νομα |
alpha-Phenylcinnamic acid; a-Phenyl-trans-cinnamic acid, Pract.; a-(Phenylmethylene)benzeneacetic acid, Pract.; Phenylcinnamicacid,98%; (2E)-2,3-diphenylprop-2-enoic acid; 2,3-diphenylprop-2-enoic acid; (2Z)-2,3-diphenylprop-2-enoic acid; (2E)-2,3-diphenylprop-2-enoate; (2Z)-2,3-diphenylprop-2-enoate |
| MF |
C15H11O2 |
| Μοριακ? β?ρο? |
223.2472 |
| InChI |
InChI=1/C15H12O2/c16-15(17)14(13-9-5-2-6-10-13)11-12-7-3-1-4-8-12/h1-11H,(H,16,17)/p-1/b14-11- |
| CAS ΟΧΙ |
91-48-5 |
| EINECS |
202-069-4 |
| Μοριακ? δομ? |
|
| Σημε?ο τ?ξη? |
171-175℃ |
| Σημε?ο βρασμο? |
336.6°C at 760 mmHg |
| Σημε?ο αν?φλεξη? |
239.8°C |
| Π?εση ατμ?ν |
4.35E-05mmHg at 25°C |
| Περιγραφ? τη? ασφ?λεια? |
S24/25:Avoid contact with skin and eyes.;
|
|