91-48-5 alpha-Phenylcinnamic acid
| product Name |
alpha-Phenylcinnamic acid |
| CAS No |
91-48-5 |
| Synonyms |
a-Phenyl-trans-cinnamic acid, Pract.; a-(Phenylmethylene)benzeneacetic acid, Pract.; Phenylcinnamicacid,98%; (2E)-2,3-diphenylprop-2-enoic acid; 2,3-diphenylprop-2-enoic acid; (2Z)-2,3-diphenylprop-2-enoic acid; (2E)-2,3-diphenylprop-2-enoate; (2Z)-2,3-diphenylprop-2-enoate |
| Molecular Formula |
C15H11O2 |
| Molecular Weight |
223.2472 |
| InChI |
InChI=1/C15H12O2/c16-15(17)14(13-9-5-2-6-10-13)11-12-7-3-1-4-8-12/h1-11H,(H,16,17)/p-1/b14-11- |
| EINECS |
202-069-4 |
| Molecular Structure |
|
| Melting point |
171-175℃ |
| Boiling point |
336.6°C at 760 mmHg |
| Flash point |
239.8°C |
| Vapour Pressur |
4.35E-05mmHg at 25°C |
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
Featured China Suppliers
| Contact |
Jason Jing |
| Telephone |
+86-571-85586718 |
| Email |
sales@capot.com |
| Address |
Wanlun Sci Park,No.88 Jiangling RD,Hangzhou, Zhejiang, China, 310051 |