ChemNet > CAS > 36304-40-2 2-Chlorophenoxyacetic acid hydrazide
36304-40-2 2-Chlorophenoxyacetic acid hydrazide
| Ονομασ?α του προ??ντο? |
2-Chlorophenoxyacetic acid hydrazide |
| Αγγλικ? ?νομα |
2-Chlorophenoxyacetic acid hydrazide; ASISCHEM U30989; AKOS BBB/158; 2-Chlorophenoxyacetic acid hydrazide 98%; 2-(2-chlorophenoxy)acetohydrazide |
| MF |
C8H9ClN2O2 |
| Μοριακ? β?ρο? |
200.6223 |
| InChI |
InChI=1/C8H9ClN2O2/c9-6-3-1-2-4-7(6)13-5-8(12)11-10/h1-4H,5,10H2,(H,11,12) |
| CAS ΟΧΙ |
36304-40-2 |
| Μοριακ? δομ? |
|
| Πυκν?τητα |
1.324g/cm3 |
| Σημε?ο βρασμο? |
419.8°C at 760 mmHg |
| Δε?κτη? δι?θλαση? |
1.568 |
| Σημε?ο αν?φλεξη? |
207.7°C |
| Π?εση ατμ?ν |
2.95E-07mmHg at 25°C |
| Σ?μβολα επικινδυν?τητα? |
Xi:;
|
| Κινδ?νου Κ?δικε? |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Περιγραφ? τη? ασφ?λεια? |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|