ChemNet > CAS > 36304-40-2 2-Chlorophenoxyacetic acid hydrazide
36304-40-2 2-Chlorophenoxyacetic acid hydrazide
| product Name |
2-Chlorophenoxyacetic acid hydrazide |
| CAS No |
36304-40-2 |
| Synonyms |
ASISCHEM U30989; AKOS BBB/158; 2-Chlorophenoxyacetic acid hydrazide 98%; 2-(2-chlorophenoxy)acetohydrazide |
| Molecular Formula |
C8H9ClN2O2 |
| Molecular Weight |
200.6223 |
| InChI |
InChI=1/C8H9ClN2O2/c9-6-3-1-2-4-7(6)13-5-8(12)11-10/h1-4H,5,10H2,(H,11,12) |
| Molecular Structure |
|
| Density |
1.324g/cm3 |
| Boiling point |
419.8°C at 760 mmHg |
| Refractive index |
1.568 |
| Flash point |
207.7°C |
| Vapour Pressur |
2.95E-07mmHg at 25°C |
| Hazard Symbols |
Xi:;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|