4165-96-2 3-Phenylglutaric acid
| Nom |
3-Phenylglutaric acid |
| Nom anglais |
3-Phenylglutaric acid;3-phenylpentanedioic acid; 3-phenylpentanedioate |
| Formule moléculaire |
C11H10O4 |
| Poids Moléculaire |
206.1958 |
| InChI |
InChI=1/C11H12O4/c12-10(13)6-9(7-11(14)15)8-4-2-1-3-5-8/h1-5,9H,6-7H2,(H,12,13)(H,14,15)/p-2 |
| Numéro de registre CAS |
4165-96-2 |
| EINECS |
224-016-4 |
| Structure moléculaire |
|
| Point de fusion |
140-143℃ |
| Point d'ébullition |
359.4°C at 760 mmHg |
| Point d'éclair |
185.3°C |
| Pression de vapeur |
8.61E-06mmHg at 25°C |
| Description de sécurité |
S24/25:Avoid contact with skin and eyes.;
|
|