4165-96-2 3-Phenylglutaric acid
| product Name |
3-Phenylglutaric acid |
| CAS No |
4165-96-2 |
| Synonyms |
3-phenylpentanedioic acid; 3-phenylpentanedioate |
| Molecular Formula |
C11H10O4 |
| Molecular Weight |
206.1958 |
| InChI |
InChI=1/C11H12O4/c12-10(13)6-9(7-11(14)15)8-4-2-1-3-5-8/h1-5,9H,6-7H2,(H,12,13)(H,14,15)/p-2 |
| EINECS |
224-016-4 |
| Molecular Structure |
|
| Melting point |
140-143℃ |
| Boiling point |
359.4°C at 760 mmHg |
| Flash point |
185.3°C |
| Vapour Pressur |
8.61E-06mmHg at 25°C |
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
Featured China Suppliers
| Contact |
Jason Jing |
| Telephone |
+86-571-85586718 |
| Email |
sales@capot.com |
| Address |
Wanlun Sci Park,No.88 Jiangling RD,Hangzhou, Zhejiang, China, 310051 |