106-57-0 Glycine anhydride
| Nombre del producto |
Glycine anhydride |
| Nombre en inglés |
Glycine anhydride; 2,5-Diketopiperazine; 2,5-Piperazinedione,(Glycine anhydride); Dioxo Piperazine; Cyclo(-Gly-Gly); 2,5-Piperazinedione; piperazine-2,5-dione; piperazine-2,3-dione |
| Fórmula molecular |
C4H6N2O2 |
| Peso Molecular |
114.1026 |
| InChI |
InChI=1/C4H6N2O2/c7-3-4(8)6-2-1-5-3/h1-2H2,(H,5,7)(H,6,8) |
| Número de registro CAS |
106-57-0 |
| EINECS |
203-411-5 |
| Estructura Molecular |
|
| Densidad |
1.246g/cm3 |
| Punto de fusión |
300℃ |
| índice de refracción |
1.467 |
| Descripción de Seguridad |
S24/25:Avoid contact with skin and eyes.;
|
|