106-57-0 Glycine anhydride
| product Name |
Glycine anhydride |
| CAS No |
106-57-0 |
| Synonyms |
2,5-Diketopiperazine; 2,5-Piperazinedione,(Glycine anhydride); Dioxo Piperazine; Cyclo(-Gly-Gly); 2,5-Piperazinedione; piperazine-2,5-dione; piperazine-2,3-dione |
| Molecular Formula |
C4H6N2O2 |
| Molecular Weight |
114.1026 |
| InChI |
InChI=1/C4H6N2O2/c7-3-4(8)6-2-1-5-3/h1-2H2,(H,5,7)(H,6,8) |
| EINECS |
203-411-5 |
| Molecular Structure |
|
| Density |
1.246g/cm3 |
| Melting point |
300℃ |
| Refractive index |
1.467 |
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
Featured China Suppliers
| Contact |
Sergei Gresko |
| Telephone |
+380623854830 |
| Email |
sales@intermedchemicals.com |
| Address |
17-a Bakinsky Kommissarov Str. 83049 Donetsk UKRAINE |