541-88-8 Chloroacetic anhydride
| product Name |
Chloroacetic anhydride |
| CAS No |
541-88-8 |
| Synonyms |
Chloracetic anhydride; 2-Chloroacetic anhydride; AI3-52321; Acetic acid, chloro-, anhydride; Chloroacetic acid anhydride; Chloroacetyl anhydride; Chloroethanoic anhydride; HSDB 5685; Monochloroacetic acid anhydride; NSC 71207; Sym-dichloroacetic anhydride; alpha,alpha'-Dichloroacetic anhydride; Acetic acid, 2-chloro-, 1,1'-anhydride; methyl 3-chloro-4-fluorobutanoate; (2-chloroacetyl) 2-chloroacetate |
| Molecular Formula |
C4H4Cl2O3 |
| Molecular Weight |
170.9788 |
| InChI |
InChI=1/C4H4Cl2O3/c5-1-3(7)9-4(8)2-6/h1-2H2 |
| EINECS |
208-794-2 |
| Molecular Structure |
|
| Density |
1.449g/cm3 |
| Melting point |
54-58℃ |
| Boiling point |
203°C at 760 mmHg |
| Refractive index |
1.456 |
| Flash point |
82.8°C |
| Vapour Pressur |
0.284mmHg at 25°C |
| Hazard Symbols |
T:Toxic;
|
| Risk Codes |
R23/24/25:Toxic by inhalation, in contact with skin and if swallowed.;
R35:Causes severe burns.;
|
| Safety Description |
S22:Do not inhale dust.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
| MSDS |
Material Safety Data Sheet
|
|
Featured China Suppliers
| Contact |
Mr.Chen |
| Telephone |
+86-571-87040515 |
| Email |
chenhk@hzph.com |
| Address |
QinglianBldg.No,139QingchunRd,HangzhouCity,Zhejiang,China |
| Description |
CAS??541-88-8 MF??C4H4Cl2O3 MW??170.98 Appearance ??White crystalline powder m.p.??51°C b.p.??203°C Purity??≥96% |
| Contact |
Max Meng |
| Telephone |
+86-18602119550 |
| Email |
sale@jhchemical.cn |
| Address |
No.2, Gongye First Road, Taiwan Industrial Park, Gaoqing county, Zibo, Shandong |