541-88-8 Chloroacetic anhydride
| Produkt-Name |
Chloroacetic anhydride |
| Englischer Name |
Chloroacetic anhydride;Chloracetic anhydride; 2-Chloroacetic anhydride; AI3-52321; Acetic acid, chloro-, anhydride; Chloroacetic acid anhydride; Chloroacetyl anhydride; Chloroethanoic anhydride; HSDB 5685; Monochloroacetic acid anhydride; NSC 71207; Sym-dichloroacetic anhydride; alpha,alpha'-Dichloroacetic anhydride; Acetic acid, 2-chloro-, 1,1'-anhydride; methyl 3-chloro-4-fluorobutanoate; (2-chloroacetyl) 2-chloroacetate |
| Molekulare Formel |
C4H4Cl2O3 |
| Molecular Weight |
170.9788 |
| InChI |
InChI=1/C4H4Cl2O3/c5-1-3(7)9-4(8)2-6/h1-2H2 |
| CAS Registry Number |
541-88-8 |
| EINECS |
208-794-2 |
| Molecular Structure |
|
| Dichte |
1.449g/cm3 |
| Schmelzpunkt |
54-58℃ |
| Siedepunkt |
203°C at 760 mmHg |
| Brechungsindex |
1.456 |
| Flammpunkt |
82.8°C |
| Dampfdruck |
0.284mmHg at 25°C |
| Gefahrensymbole |
T:Toxic;
|
| Risk Codes |
R23/24/25:Toxic by inhalation, in contact with skin and if swallowed.;
R35:Causes severe burns.;
|
| Safety Beschreibung |
S22:Do not inhale dust.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|