ChemNet > CAS > 5331-91-9 5-Chloro-2-mercaptobenzothiazole
5331-91-9 5-Chloro-2-mercaptobenzothiazole
| product Name |
5-Chloro-2-mercaptobenzothiazole |
| CAS No |
5331-91-9 |
| Synonyms |
5-Chloro-2-benzothiazolethiol; 5-Chloro-2-mercaptobenzthiazol; 2(3H)-Benzothiazolethione,4-chloro-(9CI); 2-mercapto-5-chloro benzothiazole; 5-chloro-1,3-benzothiazole-2(3H)-thione |
| Molecular Formula |
C7H4ClNS2 |
| Molecular Weight |
201.6964 |
| InChI |
InChI=1/C7H4ClNS2/c8-4-1-2-6-5(3-4)9-7(10)11-6/h1-3H,(H,9,10) |
| EINECS |
226-235-0 |
| Molecular Structure |
|
| Density |
1.6g/cm3 |
| Melting point |
198-200℃ |
| Boiling point |
333.2°C at 760 mmHg |
| Refractive index |
1.785 |
| Flash point |
155.3°C |
| Vapour Pressur |
0.000138mmHg at 25°C |
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
Featured China Suppliers
| Telephone |
+86-21-61066956/57/58??61043548 |
| Email |
sales@domen.com.cn |
| Address |
Rm1907, Bldg A, No.1088 Xinjinqiao Rd, Pudong, Shanghai, China |
| Description |
Chemical name: 5-Chloro-2-mercaptobenzothiazole CAS:5331-91-9 Molecular formula:C7H4ClNS2 Molecular weight:201.69 Appearance: Content:99% |
| Contact |
Sunny liu |
| Telephone |
021-68758016 |
| Email |
chemvia@chemvia.com |
| Address |
22F, Huadu Mansion, No. 838, Zhangyang Rd, Pudong,Shanghai, China |