ChemNet > CAS > 5331-91-9 5-Chloro-2-mercaptobenzothiazole
5331-91-9 5-Chloro-2-mercaptobenzothiazole
| Produkt-Name |
5-Chloro-2-mercaptobenzothiazole |
| Englischer Name |
5-Chloro-2-mercaptobenzothiazole; 5-Chloro-2-benzothiazolethiol; 5-Chloro-2-mercaptobenzthiazol; 2(3H)-Benzothiazolethione,4-chloro-(9CI); 2-mercapto-5-chloro benzothiazole; 5-chloro-1,3-benzothiazole-2(3H)-thione |
| Molekulare Formel |
C7H4ClNS2 |
| Molecular Weight |
201.6964 |
| InChI |
InChI=1/C7H4ClNS2/c8-4-1-2-6-5(3-4)9-7(10)11-6/h1-3H,(H,9,10) |
| CAS Registry Number |
5331-91-9 |
| EINECS |
226-235-0 |
| Molecular Structure |
|
| Dichte |
1.6g/cm3 |
| Schmelzpunkt |
198-200℃ |
| Siedepunkt |
333.2°C at 760 mmHg |
| Brechungsindex |
1.785 |
| Flammpunkt |
155.3°C |
| Dampfdruck |
0.000138mmHg at 25°C |
| Safety Beschreibung |
S24/25:Avoid contact with skin and eyes.;
|
|