ChemNet > CAS > 1141-45-3 3-(2-Naphthylthio)propionic acid
1141-45-3 3-(2-Naphthylthio)propionic acid
| product Name |
3-(2-Naphthylthio)propionic acid |
| CAS No |
1141-45-3 |
| Synonyms |
3-(2-Naphthylmercapto)propionic acid; 3-(naphthalen-2-ylsulfanyl)propanoic acid |
| Molecular Formula |
C13H12O2S |
| Molecular Weight |
232.2982 |
| InChI |
InChI=1/C13H12O2S/c14-13(15)7-8-16-12-6-5-10-3-1-2-4-11(10)9-12/h1-6,9H,7-8H2,(H,14,15) |
| Molecular Structure |
|
| Density |
1.27g/cm3 |
| Boiling point |
440.6°C at 760 mmHg |
| Refractive index |
1.668 |
| Flash point |
220.3°C |
| Vapour Pressur |
1.53E-08mmHg at 25°C |
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|