ChemNet > CAS > 1141-45-3 3-(2-Naphthylthio)propionic acid
1141-45-3 3-(2-Naphthylthio)propionic acid
| Produkt-Name |
3-(2-Naphthylthio)propionic acid |
| Englischer Name |
3-(2-Naphthylthio)propionic acid; 3-(2-Naphthylmercapto)propionic acid; 3-(naphthalen-2-ylsulfanyl)propanoic acid |
| Molekulare Formel |
C13H12O2S |
| Molecular Weight |
232.2982 |
| InChI |
InChI=1/C13H12O2S/c14-13(15)7-8-16-12-6-5-10-3-1-2-4-11(10)9-12/h1-6,9H,7-8H2,(H,14,15) |
| CAS Registry Number |
1141-45-3 |
| Molecular Structure |
|
| Dichte |
1.27g/cm3 |
| Siedepunkt |
440.6°C at 760 mmHg |
| Brechungsindex |
1.668 |
| Flammpunkt |
220.3°C |
| Dampfdruck |
1.53E-08mmHg at 25°C |
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Beschreibung |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|