1120-06-5 2-Decanol
| product Name |
2-Decanol |
| CAS No |
1120-06-5 |
| Synonyms |
Methyl n-octyl carbinol; decan-2-ol; (2S)-decan-2-ol |
| Molecular Formula |
C10H22O |
| Molecular Weight |
158.2811 |
| InChI |
InChI=1/C10H22O/c1-3-4-5-6-7-8-9-10(2)11/h10-11H,3-9H2,1-2H3/t10-/m0/s1 |
| EINECS |
214-296-6 |
| Molecular Structure |
|
| Density |
0.826g/cm3 |
| Melting point |
-5℃ |
| Boiling point |
212.2°C at 760 mmHg |
| Refractive index |
1.434 |
| Flash point |
85°C |
| Vapour Pressur |
0.0393mmHg at 25°C |
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|