1120-06-5 2-Decanol
| Produkt-Name |
2-Decanol |
| Englischer Name |
2-Decanol; Methyl n-octyl carbinol; decan-2-ol; (2S)-decan-2-ol |
| Molekulare Formel |
C10H22O |
| Molecular Weight |
158.2811 |
| InChI |
InChI=1/C10H22O/c1-3-4-5-6-7-8-9-10(2)11/h10-11H,3-9H2,1-2H3/t10-/m0/s1 |
| CAS Registry Number |
1120-06-5 |
| EINECS |
214-296-6 |
| Molecular Structure |
|
| Dichte |
0.826g/cm3 |
| Schmelzpunkt |
-5℃ |
| Siedepunkt |
212.2°C at 760 mmHg |
| Brechungsindex |
1.434 |
| Flammpunkt |
85°C |
| Dampfdruck |
0.0393mmHg at 25°C |
| Safety Beschreibung |
S24/25:Avoid contact with skin and eyes.;
|
|