ChemNet > CAS > 959-28-4 trans-1,2-Dibenzoylethylene
959-28-4 trans-1,2-Dibenzoylethylene
| ürün Ad? |
trans-1,2-Dibenzoylethylene |
| ingilizce ad? |
trans-1,2-Dibenzoylethylene; trans-1,4-Diphenyl-2-butene-1,4-dione; 1,2-Dibenzoylethylene, perdominantly trans, (trans-1,4-Diphenyl-2-butene-1,4-dione); (2E)-1,4-diphenylbut-2-ene-1,4-dione |
| Moleküler Formülü |
C16H12O2 |
| Molekül A??rl??? |
236.2653 |
| InChI |
InChI=1/C16H12O2/c17-15(13-7-3-1-4-8-13)11-12-16(18)14-9-5-2-6-10-14/h1-12H/b12-11+ |
| CAS kay?t numaras? |
959-28-4 |
| EINECS |
213-498-1 |
| Moleküler Yap?s? |
|
| Yo?unluk |
1.141g/cm3 |
| Ergime noktas? |
108-112℃ |
| Kaynama noktas? |
368.5°C at 760 mmHg |
| K?r?lma indisi |
1.597 |
| Alevlenme noktas? |
138.2°C |
| Buhar bas?nc? |
1.27E-05mmHg at 25°C |
| Güvenlik A??klamas? |
S24/25:Avoid contact with skin and eyes.;
|
|