95-26-1 2,5-Dimethylbenzothiazole
| ürün Ad? |
2,5-Dimethylbenzothiazole |
| ingilizce ad? |
2,5-Dimethylbenzothiazole;Benzothiazole, 2,5-dimethyl-; 2,5-Dimethylbenzthiazol; 2,5-Dimethylbenzthiazol [Czech]; 4-27-00-01101 (Beilstein Handbook Reference); BRN 0116455; 2,5-dimethyl-1,3-benzothiazole |
| Moleküler Formülü |
C9H9NS |
| Molekül A??rl??? |
163.2395 |
| InChI |
InChI=1/C9H9NS/c1-6-3-4-9-8(5-6)10-7(2)11-9/h3-5H,1-2H3 |
| CAS kay?t numaras? |
95-26-1 |
| EINECS |
202-404-4 |
| Moleküler Yap?s? |
|
| Yo?unluk |
1.176g/cm3 |
| Ergime noktas? |
36-40℃ |
| Kaynama noktas? |
259.4°C at 760 mmHg |
| K?r?lma indisi |
1.643 |
| Alevlenme noktas? |
112.7°C |
| Buhar bas?nc? |
0.021mmHg at 25°C |
| Tehlike Sembolleri |
Xn:Harmful;
|
| Risk Kodlar? |
R22:Harmful if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Güvenlik A??klamas? |
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|