ChemNet > CAS > 90-24-4 2-Hydroxy-4,6-dimethoxyacetophenone
90-24-4 2-Hydroxy-4,6-dimethoxyacetophenone
| ürün Ad? |
2-Hydroxy-4,6-dimethoxyacetophenone |
| ingilizce ad? |
2-Hydroxy-4,6-dimethoxyacetophenone; xanthoxylin |
| Moleküler Formülü |
C10H12O4 |
| Molekül A??rl??? |
196.1999 |
| InChI |
InChI=1/C10H12O4/c1-6(11)10-8(12)4-7(13-2)5-9(10)14-3/h4-5,12H,1-3H3 |
| CAS kay?t numaras? |
90-24-4 |
| EINECS |
201-978-3 |
| Moleküler Yap?s? |
|
| Yo?unluk |
1.172g/cm3 |
| Ergime noktas? |
80-82℃ |
| Kaynama noktas? |
355.1°C at 760 mmHg |
| K?r?lma indisi |
1.527 |
| Alevlenme noktas? |
141.2°C |
| Buhar bas?nc? |
1.57E-05mmHg at 25°C |
| Risk Kodlar? |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Güvenlik A??klamas? |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|