853-39-4 Decafluorobenzophenone
| ürün Ad? |
Decafluorobenzophenone |
| ingilizce ad? |
Decafluorobenzophenone; |
| Moleküler Formülü |
C13F10O |
| Molekül A??rl??? |
362.12 |
| InChI |
InChI=1/C13F10O/c14-3-1(4(15)8(19)11(22)7(3)18)13(24)2-5(16)9(20)12(23)10(21)6(2)17 |
| CAS kay?t numaras? |
853-39-4 |
| EINECS |
212-717-8 |
| Moleküler Yap?s? |
|
| Ergime noktas? |
92-94℃ |
| Tehlike Sembolleri |
Xi:Irritant;
|
| Risk Kodlar? |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Güvenlik A??klamas? |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|