782-17-2 2-(4-Fluorophenyl)indole
| ürün Ad? |
2-(4-Fluorophenyl)indole |
| ingilizce ad? |
2-(4-Fluorophenyl)indole; 2-(naphth-2-yl)-1h-indole; 2-(4-fluorophenyl)-1H-indole; 6-(4-fluorophenyl)-1H-indole |
| Moleküler Formülü |
C14H10FN |
| Molekül A??rl??? |
211.2343 |
| InChI |
InChI=1/C14H10FN/c15-13-5-3-10(4-6-13)12-2-1-11-7-8-16-14(11)9-12/h1-9,16H |
| CAS kay?t numaras? |
782-17-2 |
| Moleküler Yap?s? |
|
| Yo?unluk |
1.233g/cm3 |
| Ergime noktas? |
190-192℃ |
| Kaynama noktas? |
389.094°C at 760 mmHg |
| K?r?lma indisi |
1.658 |
| Alevlenme noktas? |
189.118°C |
| Buhar bas?nc? |
0mmHg at 25°C |
| Tehlike Sembolleri |
Xi:Irritant;
|
| Risk Kodlar? |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Güvenlik A??klamas? |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|