ChemNet > CAS > 72-55-9 2,2-Bis(4-chlorophenyl)-1,1-dichloroethylene
72-55-9 2,2-Bis(4-chlorophenyl)-1,1-dichloroethylene
| ürün Ad? |
2,2-Bis(4-chlorophenyl)-1,1-dichloroethylene |
| ingilizce ad? |
2,2-Bis(4-chlorophenyl)-1,1-dichloroethylene;p,p-DDE |
| Moleküler Formülü |
C14H8Cl4 |
| Molekül A??rl??? |
318.02 |
| InChI |
InChI=1/C14H8Cl4/c15-11-5-1-9(2-6-11)13(14(17)18)10-3-7-12(16)8-4-10/h1-8H |
| CAS kay?t numaras? |
72-55-9 |
| EINECS |
200-784-6 |
| Moleküler Yap?s? |
|
| Ergime noktas? |
87-90℃ |
| Suda ??zünürlük |
0.00000013 g/100 mL |
| Tehlike Sembolleri |
Xn:Harmful;
|
| Risk Kodlar? |
R22:Harmful if swallowed.;
R33:Danger of cummulative effects.;
|
| Güvenlik A??klamas? |
S24/25:Avoid contact with skin and eyes.;
|
|