ChemNet > CAS > 703-23-1 2-Hydroxy-6-methoxyacetophenone
703-23-1 2-Hydroxy-6-methoxyacetophenone
| ürün Ad? |
2-Hydroxy-6-methoxyacetophenone |
| ingilizce ad? |
2-Hydroxy-6-methoxyacetophenone; 1-(2-Hydroxy-6-methoxyphenyl)ethan-1-one; 1-(2-hydroxy-6-methoxyphenyl)ethanone; 2'-Hydroxy-6'-methoxyacetophenone |
| Moleküler Formülü |
C9H10O3 |
| Molekül A??rl??? |
166.1739 |
| InChI |
InChI=1/C9H10O3/c1-6(10)9-7(11)4-3-5-8(9)12-2/h3-5,11H,1-2H3 |
| CAS kay?t numaras? |
703-23-1 |
| EINECS |
211-872-9 |
| Moleküler Yap?s? |
|
| Yo?unluk |
1.158g/cm3 |
| Ergime noktas? |
58-60℃ |
| Kaynama noktas? |
259.5°C at 760 mmHg |
| K?r?lma indisi |
1.537 |
| Alevlenme noktas? |
108.1°C |
| Buhar bas?nc? |
0.00798mmHg at 25°C |
| Risk Kodlar? |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Güvenlik A??klamas? |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|